Details for 2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene

2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene
| Category: |
Intermediates/Pharmaceutical intermediates |
|
| CAS NO: |
898566-17-1 |
| EC NO: |
|
| Molecular Formula: |
C18H14FIS |
| Molecular Weight: |
408.27 |
| Specification: |
|
| InChI: |
InChI=1/C18H14FIS/c1-12-2-7-16(20)10-14(12)11-17-8-9-18(21-17)13-3-5-15(19)6-4-13/h2-10H,11H2,1H3 |
| Synonyms: |
2-(4-fluorophenyl)-5-((5-iodo-2-methylphenyl)methyl)thiophene;2-(4-fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]-Thiophene;2-((5-IODO-2-METHYLPHENYL)METHYL)-5-(4-FLUOROPHENYL)THIOPHENE; |
| Molecular Structure: |
![2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene 898566-17-1](https://images-a.chemnet.com/suppliers/chembase/cas8/cas898566-17-1.gif) |
if you are sourcing 2-(4-Fluorophenyl)-5-[(5-iodo-2-methylphenyl)methyl]thiophene from China ,just feel free to inquire